C18H19NO3S2 — CID 144921547
(3aR,7aS)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiole 2-oxide;10H-phenothiazine (PubChem CID 144921547) has the molecular formula C18H19NO3S2 and a molecular weight of 361.49 g/mol. Its IUPAC name is (3aR,7aS)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiole 2-oxide;10H-phenothiazine.
| Compound Name | (3aR,7aS)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiole 2-oxide;10H-phenothiazine |
|---|---|
| PubChem CID | 144921547 |
| Molecular Formula | C18H19NO3S2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | (3aR,7aS)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiole 2-oxide;10H-phenothiazine |
| SMILES | O=S1O[C@H]2CCCC[C@H]2O1.c1ccc2c(c1)Nc1ccccc1S2 |
| InChI | InChI=1S/C12H9NS.C6H10O3S/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11;7-10-8-5-3-1-2-4-6(5)9-10/h1-8,13H;5-6H,1-4H2/t;5-,6+,10? |
| InChIKey | MTPWHVVNMDLXOX-POJKYNLASA-N |
| XLogP | 4.82 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|