C26H31N3O2S — CID 139680561
1,4-dihexoxy-10H-phenothiazine-2,3-dicarbonitrile (PubChem CID 139680561) has the molecular formula C26H31N3O2S and a molecular weight of 449.62 g/mol. Its IUPAC name is 1,4-dihexoxy-10H-phenothiazine-2,3-dicarbonitrile.
| Compound Name | 1,4-dihexoxy-10H-phenothiazine-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 139680561 |
| Molecular Formula | C26H31N3O2S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 1,4-dihexoxy-10H-phenothiazine-2,3-dicarbonitrile |
| SMILES | CCCCCCOc1c(C#N)c(C#N)c(OCCCCCC)c2c1Nc1ccccc1S2 |
| InChI | InChI=1S/C26H31N3O2S/c1-3-5-7-11-15-30-24-19(17-27)20(18-28)25(31-16-12-8-6-4-2)26-23(24)29-21-13-9-10-14-22(21)32-26/h9-10,13-14,29H,3-8,11-12,15-16H2,1-2H3 |
| InChIKey | YYWBFNXHBOCLEH-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|