C18H23N3S — CID 142426961
2-heptyl-4-methyl-10H-pyrimido[5,4-b][1,4]benzothiazine (PubChem CID 142426961) has the molecular formula C18H23N3S and a molecular weight of 313.47 g/mol. Its IUPAC name is 2-heptyl-4-methyl-10H-pyrimido[5,4-b][1,4]benzothiazine.
| Compound Name | 2-heptyl-4-methyl-10H-pyrimido[5,4-b][1,4]benzothiazine |
|---|---|
| PubChem CID | 142426961 |
| Molecular Formula | C18H23N3S |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 2-heptyl-4-methyl-10H-pyrimido[5,4-b][1,4]benzothiazine |
| SMILES | CCCCCCCc1nc(C)c2c(n1)Nc1ccccc1S2 |
| InChI | InChI=1S/C18H23N3S/c1-3-4-5-6-7-12-16-19-13(2)17-18(21-16)20-14-10-8-9-11-15(14)22-17/h8-11H,3-7,12H2,1-2H3,(H,19,20,21) |
| InChIKey | DNYZQBHDWOHGSX-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|