C31H41N3O2S — CID 139680602
10-methyl-1,4-dioctoxyphenothiazine-2,3-dicarbonitrile (PubChem CID 139680602) has the molecular formula C31H41N3O2S and a molecular weight of 519.76 g/mol. Its IUPAC name is 10-methyl-1,4-dioctoxyphenothiazine-2,3-dicarbonitrile.
| Compound Name | 10-methyl-1,4-dioctoxyphenothiazine-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 139680602 |
| Molecular Formula | C31H41N3O2S |
| Molecular Weight | 519.76 g/mol |
| Exact Mass | 519.29 |
| IUPAC Name | 10-methyl-1,4-dioctoxyphenothiazine-2,3-dicarbonitrile |
| SMILES | CCCCCCCCOc1c(C#N)c(C#N)c(OCCCCCCCC)c2c1Sc1ccccc1N2C |
| InChI | InChI=1S/C31H41N3O2S/c1-4-6-8-10-12-16-20-35-29-24(22-32)25(23-33)30(36-21-17-13-11-9-7-5-2)31-28(29)34(3)26-18-14-15-19-27(26)37-31/h14-15,18-19H,4-13,16-17,20-21H2,1-3H3 |
| InChIKey | HEJNDSVJJYUESQ-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 69.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.76 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|