C23H25N3O3S — CID 139680491
1-(2,2-diethoxyethoxy)-10-propylphenothiazine-2,3-dicarbonitrile (PubChem CID 139680491) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is 1-(2,2-diethoxyethoxy)-10-propylphenothiazine-2,3-dicarbonitrile.
| Compound Name | 1-(2,2-diethoxyethoxy)-10-propylphenothiazine-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 139680491 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 1-(2,2-diethoxyethoxy)-10-propylphenothiazine-2,3-dicarbonitrile |
| SMILES | CCCN1c2ccccc2Sc2cc(C#N)c(C#N)c(OCC(OCC)OCC)c21 |
| InChI | InChI=1S/C23H25N3O3S/c1-4-11-26-18-9-7-8-10-19(18)30-20-12-16(13-24)17(14-25)23(22(20)26)29-15-21(27-5-2)28-6-3/h7-10,12,21H,4-6,11,15H2,1-3H3 |
| InChIKey | SAPYHKREVQCFRR-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 78.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|