C19H24N2S — CID 172808842
N,N-diethyl-2-(10H-phenothiazin-1-yl)propan-1-amine (PubChem CID 172808842) has the molecular formula C19H24N2S and a molecular weight of 312.48 g/mol. Its IUPAC name is N,N-diethyl-2-(10H-phenothiazin-1-yl)propan-1-amine.
| Compound Name | N,N-diethyl-2-(10H-phenothiazin-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 172808842 |
| Molecular Formula | C19H24N2S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | N,N-diethyl-2-(10H-phenothiazin-1-yl)propan-1-amine |
| SMILES | CCN(CC)CC(C)c1cccc2c1Nc1ccccc1S2 |
| InChI | InChI=1S/C19H24N2S/c1-4-21(5-2)13-14(3)15-9-8-12-18-19(15)20-16-10-6-7-11-17(16)22-18/h6-12,14,20H,4-5,13H2,1-3H3 |
| InChIKey | RWSIZTIFAJALSN-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |