C54H25F12N5S — CID 137369213
4,6-bis[3,6-bis(trifluoromethyl)carbazol-9-yl]-2-(10-phenylphenothiazin-1-yl)benzene-1,3-dicarbonitrile (PubChem CID 137369213) has the molecular formula C54H25F12N5S and a molecular weight of 1003.87 g/mol. Its IUPAC name is 4,6-bis[3,6-bis(trifluoromethyl)carbazol-9-yl]-2-(10-phenylphenothiazin-1-yl)benzene-1,3-dicarbonitrile.
| Compound Name | 4,6-bis[3,6-bis(trifluoromethyl)carbazol-9-yl]-2-(10-phenylphenothiazin-1-yl)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 137369213 |
| Molecular Formula | C54H25F12N5S |
| Molecular Weight | 1003.87 g/mol |
| Exact Mass | 1003.16 |
| IUPAC Name | 4,6-bis[3,6-bis(trifluoromethyl)carbazol-9-yl]-2-(10-phenylphenothiazin-1-yl)benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1c(-n2c3ccc(C(F)(F)F)cc3c3cc(C(F)(F)F)ccc32)cc(-n2c3ccc(C(F)(F)F)cc3c3cc(C(F)(F)F)ccc32)c(C#N)c1-c1cccc2c1N(c1ccccc1)c1ccccc1S2 |
| InChI | InChI=1S/C54H25F12N5S/c55-51(56,57)28-13-17-40-34(21-28)35-22-29(52(58,59)60)14-18-41(35)70(40)45-25-46(71-42-19-15-30(53(61,62)63)23-36(42)37-24-31(54(64,65)66)16-20-43(37)71)39(27-68)49(38(45)26-67)33-9-6-12-48-50(33)69(32-7-2-1-3-8-32)44-10-4-5-11-47(44)72-48/h1-25H |
| InChIKey | JTMQTXAGDZQUOP-UHFFFAOYSA-N |
| XLogP | 17.30 |
| TPSA | 60.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1003.87 |
| LogP ≤ 5 | 17.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |