C70H38F6N6S2 — CID 137369294
2,5-bis(10-phenylphenothiazin-3-yl)-3,6-bis[2-(trifluoromethyl)carbazol-9-yl]benzene-1,4-dicarbonitrile (PubChem CID 137369294) has the molecular formula C70H38F6N6S2 and a molecular weight of 1141.24 g/mol. Its IUPAC name is 2,5-bis(10-phenylphenothiazin-3-yl)-3,6-bis[2-(trifluoromethyl)carbazol-9-yl]benzene-1,4-dicarbonitrile.
| Compound Name | 2,5-bis(10-phenylphenothiazin-3-yl)-3,6-bis[2-(trifluoromethyl)carbazol-9-yl]benzene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 137369294 |
| Molecular Formula | C70H38F6N6S2 |
| Molecular Weight | 1141.24 g/mol |
| Exact Mass | 1140.25 |
| IUPAC Name | 2,5-bis(10-phenylphenothiazin-3-yl)-3,6-bis[2-(trifluoromethyl)carbazol-9-yl]benzene-1,4-dicarbonitrile |
| SMILES | N#Cc1c(-c2ccc3c(c2)Sc2ccccc2N3c2ccccc2)c(-n2c3ccccc3c3ccc(C(F)(F)F)cc32)c(C#N)c(-c2ccc3c(c2)Sc2ccccc2N3c2ccccc2)c1-n1c2ccccc2c2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C70H38F6N6S2/c71-69(72,73)43-29-31-49-47-19-7-9-21-53(47)81(59(49)37-43)67-52(40-78)66(42-28-34-58-64(36-42)84-62-26-14-12-24-56(62)80(58)46-17-5-2-6-18-46)68(82-54-22-10-8-20-48(54)50-32-30-44(38-60(50)82)70(74,75)76)51(39-77)65(67)41-27-33-57-63(35-41)83-61-25-13-11-23-55(61)79(57)45-15-3-1-4-16-45/h1-38H |
| InChIKey | OSEDSPXJQUFBGQ-UHFFFAOYSA-N |
| XLogP | 20.86 |
| TPSA | 63.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1141.24 |
| LogP ≤ 5 | 20.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |