About acetonitrile;ethylidyneazaniumyl-tris[2-(trifluoromethyl)phenyl]boranuide
acetonitrile;ethylidyneazaniumyl-tris[2-(trifluoromethyl)phenyl]boranuide (PubChem CID 139203148) has the molecular formula C25H18BF9N2
and a molecular weight of 528.23 g/mol. Its IUPAC name is acetonitrile;ethylidyneazaniumyl-tris[2-(trifluoromethyl)phenyl]boranuide.
Molecular Properties
| Compound Name | acetonitrile;ethylidyneazaniumyl-tris[2-(trifluoromethyl)phenyl]boranuide |
| PubChem CID | 139203148 |
| Molecular Formula | C25H18BF9N2 |
| Molecular Weight | 528.23 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | acetonitrile;ethylidyneazaniumyl-tris[2-(trifluoromethyl)phenyl]boranuide |
| SMILES | CC#N.CC#[N+][B-](c1ccccc1C(F)(F)F)(c1ccccc1C(F)(F)F)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C23H15BF9N.C2H3N/c1-2-34-24(18-12-6-3-9-15(18)21(25,26)27,19-13-7-4-10-16(19)22(28,29)30)20-14-8-5-11-17(20)23(31,32)33;1-2-3/h3-14H,1H3;1H3 |
| InChIKey | LQZGBHSZQYRDSL-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 528.23 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;ethylidyneazaniumyl-tris[2-(trifluoromethyl)phenyl]boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;ethylidyneazaniumyl-tris[2-(trifluoromethyl)phenyl]boranuide?
The IUPAC name of acetonitrile;ethylidyneazaniumyl-tris[2-(trifluoromethyl)phenyl]boranuide (CID 139203148) is acetonitrile;ethylidyneazaniumyl-tris[2-(trifluoromethyl)phenyl]boranuide.
What is the SMILES notation for acetonitrile;ethylidyneazaniumyl-tris[2-(trifluoromethyl)phenyl]boranuide?
The canonical SMILES for acetonitrile;ethylidyneazaniumyl-tris[2-(trifluoromethyl)phenyl]boranuide is CC#N.CC#[N+][B-](c1ccccc1C(F)(F)F)(c1ccccc1C(F)(F)F)c1ccccc1C(F)(F)F.
What is the InChIKey of acetonitrile;ethylidyneazaniumyl-tris[2-(trifluoromethyl)phenyl]boranuide?
The InChIKey is LQZGBHSZQYRDSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15BF9N.C2H3N/c1-2-34-24(18-12-6-3-9-15(18)21(25,26)27,19-13-7-4-10-16(19)22(28,29)30)20-14-8-5-11-17(20)23(31,32)33;1-2-3/h3-14H,1H3;1H3.
What are the key properties of acetonitrile;ethylidyneazaniumyl-tris[2-(trifluoromethyl)phenyl]boranuide?
acetonitrile;ethylidyneazaniumyl-tris[2-(trifluoromethyl)phenyl]boranuide has a molecular weight of 528.23 g/mol, XLogP of 6.59, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;ethylidyneazaniumyl-tris[2-(trifluoromethyl)phenyl]boranuide is sourced from PubChem (CID 139203148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).