C10H6Cl2F3N — CID 54101438
2,2-dichloro-3-[2-(trifluoromethyl)phenyl]propanenitrile (PubChem CID 54101438) has the molecular formula C10H6Cl2F3N and a molecular weight of 268.06 g/mol. Its IUPAC name is 2,2-dichloro-3-[2-(trifluoromethyl)phenyl]propanenitrile.
| Compound Name | 2,2-dichloro-3-[2-(trifluoromethyl)phenyl]propanenitrile |
|---|---|
| PubChem CID | 54101438 |
| Molecular Formula | C10H6Cl2F3N |
| Molecular Weight | 268.06 g/mol |
| Exact Mass | 266.98 |
| IUPAC Name | 2,2-dichloro-3-[2-(trifluoromethyl)phenyl]propanenitrile |
| SMILES | N#CC(Cl)(Cl)Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C10H6Cl2F3N/c11-9(12,6-16)5-7-3-1-2-4-8(7)10(13,14)15/h1-4H,5H2 |
| InChIKey | NATRHCZCWZFQTE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.06 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|