C13H13F3N2 — CID 163942227
propanenitrile;3-[2-(trifluoromethyl)phenyl]propanenitrile (PubChem CID 163942227) has the molecular formula C13H13F3N2 and a molecular weight of 254.25 g/mol. Its IUPAC name is propanenitrile;3-[2-(trifluoromethyl)phenyl]propanenitrile.
| Compound Name | propanenitrile;3-[2-(trifluoromethyl)phenyl]propanenitrile |
|---|---|
| PubChem CID | 163942227 |
| Molecular Formula | C13H13F3N2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | propanenitrile;3-[2-(trifluoromethyl)phenyl]propanenitrile |
| SMILES | CCC#N.N#CCCc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C10H8F3N.C3H5N/c11-10(12,13)9-6-2-1-4-8(9)5-3-7-14;1-2-3-4/h1-2,4,6H,3,5H2;2H2,1H3 |
| InChIKey | RRZLWFLZFGNGCR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |