C21H14F3N — CID 89254564
3-methyl-2,6-diphenyl-5-(trifluoromethyl)benzonitrile (PubChem CID 89254564) has the molecular formula C21H14F3N and a molecular weight of 337.34 g/mol. Its IUPAC name is 3-methyl-2,6-diphenyl-5-(trifluoromethyl)benzonitrile.
| Compound Name | 3-methyl-2,6-diphenyl-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 89254564 |
| Molecular Formula | C21H14F3N |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 3-methyl-2,6-diphenyl-5-(trifluoromethyl)benzonitrile |
| SMILES | Cc1cc(C(F)(F)F)c(-c2ccccc2)c(C#N)c1-c1ccccc1 |
| InChI | InChI=1S/C21H14F3N/c1-14-12-18(21(22,23)24)20(16-10-6-3-7-11-16)17(13-25)19(14)15-8-4-2-5-9-15/h2-12H,1H3 |
| InChIKey | AIPBFJPQAXDIFD-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |