C18H11F3N2 — CID 140991511
1,2-diphenyl-4-(trifluoromethyl)pyrrole-3-carbonitrile (PubChem CID 140991511) has the molecular formula C18H11F3N2 and a molecular weight of 312.29 g/mol. Its IUPAC name is 1,2-diphenyl-4-(trifluoromethyl)pyrrole-3-carbonitrile.
| Compound Name | 1,2-diphenyl-4-(trifluoromethyl)pyrrole-3-carbonitrile |
|---|---|
| PubChem CID | 140991511 |
| Molecular Formula | C18H11F3N2 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 1,2-diphenyl-4-(trifluoromethyl)pyrrole-3-carbonitrile |
| SMILES | N#Cc1c(C(F)(F)F)cn(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C18H11F3N2/c19-18(20,21)16-12-23(14-9-5-2-6-10-14)17(15(16)11-22)13-7-3-1-4-8-13/h1-10,12H |
| InChIKey | KVAIRIOSENOBQH-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |