C46H28N8O2P2 — CID 58400019
2-[4-(5,6-diisocyano-2-oxo-1,3-diphenyl-1,3,2λ5-benzodiazaphosphol-2-yl)phenyl]-2-oxo-1,3-diphenyl-1,3,2λ5-benzodiazaphosphole-5,6-dicarbonitrile (PubChem CID 58400019) has the molecular formula C46H28N8O2P2 and a molecular weight of 786.73 g/mol. Its IUPAC name is 2-[4-(5,6-diisocyano-2-oxo-1,3-diphenyl-1,3,2λ5-benzodiazaphosphol-2-yl)phenyl]-2-oxo-1,3-diphenyl-1,3,2λ5-benzodiazaphosphole-5,6-dicarbonitrile.
| Compound Name | 2-[4-(5,6-diisocyano-2-oxo-1,3-diphenyl-1,3,2λ5-benzodiazaphosphol-2-yl)phenyl]-2-oxo-1,3-diphenyl-1,3,2λ5-benzodiazaphosphole-5,6-dicarbonitrile |
|---|---|
| PubChem CID | 58400019 |
| Molecular Formula | C46H28N8O2P2 |
| Molecular Weight | 786.73 g/mol |
| Exact Mass | 786.18 |
| IUPAC Name | 2-[4-(5,6-diisocyano-2-oxo-1,3-diphenyl-1,3,2λ5-benzodiazaphosphol-2-yl)phenyl]-2-oxo-1,3-diphenyl-1,3,2λ5-benzodiazaphosphole-5,6-dicarbonitrile |
| SMILES | [C-]#[N+]c1cc2c(cc1[N+]#[C-])N(c1ccccc1)P(=O)(c1ccc(P3(=O)N(c4ccccc4)c4cc(C#N)c(C#N)cc4N3c3ccccc3)cc1)N2c1ccccc1 |
| InChI | InChI=1S/C46H28N8O2P2/c1-49-41-29-45-46(30-42(41)50-2)54(38-21-13-6-14-22-38)58(56,53(45)37-19-11-5-12-20-37)40-25-23-39(24-26-40)57(55)51(35-15-7-3-8-16-35)43-27-33(31-47)34(32-48)28-44(43)52(57)36-17-9-4-10-18-36/h3-30H |
| InChIKey | SQQITXPSFVNWEA-UHFFFAOYSA-N |
| XLogP | 12.15 |
| TPSA | 103.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.73 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|