C47H27N7 — CID 162426491
5-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-isocyano-2-(5-phenylindolo[3,2-b]carbazol-11-yl)benzonitrile (PubChem CID 162426491) has the molecular formula C47H27N7 and a molecular weight of 689.78 g/mol. Its IUPAC name is 5-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-isocyano-2-(5-phenylindolo[3,2-b]carbazol-11-yl)benzonitrile.
| Compound Name | 5-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-isocyano-2-(5-phenylindolo[3,2-b]carbazol-11-yl)benzonitrile |
|---|---|
| PubChem CID | 162426491 |
| Molecular Formula | C47H27N7 |
| Molecular Weight | 689.78 g/mol |
| Exact Mass | 689.23 |
| IUPAC Name | 5-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-isocyano-2-(5-phenylindolo[3,2-b]carbazol-11-yl)benzonitrile |
| SMILES | [C-]#[N+]c1cc(-n2c3ccccc3c3cc4c(cc32)c2ccccc2n4-c2ccccc2)c(C#N)cc1-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C47H27N7/c1-49-39-28-42(32(29-48)25-38(39)47-51-45(30-15-5-2-6-16-30)50-46(52-47)31-17-7-3-8-18-31)54-41-24-14-12-22-35(41)37-26-43-36(27-44(37)54)34-21-11-13-23-40(34)53(43)33-19-9-4-10-20-33/h2-28H |
| InChIKey | NLOKAVZXRVPCPW-UHFFFAOYSA-N |
| XLogP | 11.49 |
| TPSA | 76.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.78 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|