C53H31N7 — CID 140731437
2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-isocyano-5-[3-(9-phenylcarbazol-3-yl)carbazol-9-yl]benzonitrile (PubChem CID 140731437) has the molecular formula C53H31N7 and a molecular weight of 765.88 g/mol. Its IUPAC name is 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-isocyano-5-[3-(9-phenylcarbazol-3-yl)carbazol-9-yl]benzonitrile.
| Compound Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-isocyano-5-[3-(9-phenylcarbazol-3-yl)carbazol-9-yl]benzonitrile |
|---|---|
| PubChem CID | 140731437 |
| Molecular Formula | C53H31N7 |
| Molecular Weight | 765.88 g/mol |
| Exact Mass | 765.26 |
| IUPAC Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-isocyano-5-[3-(9-phenylcarbazol-3-yl)carbazol-9-yl]benzonitrile |
| SMILES | [C-]#[N+]c1cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(C#N)cc1-n1c2ccccc2c2cc(-c3ccc4c(c3)c3ccccc3n4-c3ccccc3)ccc21 |
| InChI | InChI=1S/C53H31N7/c1-55-45-32-42(53-57-51(34-15-5-2-6-16-34)56-52(58-53)35-17-7-3-8-18-35)38(33-54)31-50(45)60-47-24-14-12-22-41(47)44-30-37(26-28-49(44)60)36-25-27-48-43(29-36)40-21-11-13-23-46(40)59(48)39-19-9-4-10-20-39/h2-32H |
| InChIKey | BEMJCJHSCDVYLG-UHFFFAOYSA-N |
| XLogP | 13.16 |
| TPSA | 76.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.88 |
| LogP ≤ 5 | 13.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|