C63H46N4O2 — CID 122609903
6,7-bis(3,7-diphenylphenoxazin-10-yl)-1,1,3,3-tetramethyl-2H-indene-4,5-dicarbonitrile (PubChem CID 122609903) has the molecular formula C63H46N4O2 and a molecular weight of 891.09 g/mol. Its IUPAC name is 6,7-bis(3,7-diphenylphenoxazin-10-yl)-1,1,3,3-tetramethyl-2H-indene-4,5-dicarbonitrile.
| Compound Name | 6,7-bis(3,7-diphenylphenoxazin-10-yl)-1,1,3,3-tetramethyl-2H-indene-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 122609903 |
| Molecular Formula | C63H46N4O2 |
| Molecular Weight | 891.09 g/mol |
| Exact Mass | 890.36 |
| IUPAC Name | 6,7-bis(3,7-diphenylphenoxazin-10-yl)-1,1,3,3-tetramethyl-2H-indene-4,5-dicarbonitrile |
| SMILES | CC1(C)CC(C)(C)c2c(N3c4ccc(-c5ccccc5)cc4Oc4cc(-c5ccccc5)ccc43)c(N3c4ccc(-c5ccccc5)cc4Oc4cc(-c5ccccc5)ccc43)c(C#N)c(C#N)c21 |
| InChI | InChI=1S/C63H46N4O2/c1-62(2)39-63(3,4)59-58(62)48(37-64)49(38-65)60(66-50-29-25-44(40-17-9-5-10-18-40)33-54(50)68-55-34-45(26-30-51(55)66)41-19-11-6-12-20-41)61(59)67-52-31-27-46(42-21-13-7-14-22-42)35-56(52)69-57-36-47(28-32-53(57)67)43-23-15-8-16-24-43/h5-36H,39H2,1-4H3 |
| InChIKey | XTHPZKDPSXJYOB-UHFFFAOYSA-N |
| XLogP | 17.21 |
| TPSA | 72.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.09 |
| LogP ≤ 5 | 17.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |