C78H64BN3 — CID 123923749
7-bis(2,6-dimethylphenyl)boranyl-4,6-bis(3,6-diphenylcarbazol-9-yl)-1,1,3,3-tetramethyl-2H-indene-5-carbonitrile (PubChem CID 123923749) has the molecular formula C78H64BN3 and a molecular weight of 1054.20 g/mol. Its IUPAC name is 7-bis(2,6-dimethylphenyl)boranyl-4,6-bis(3,6-diphenylcarbazol-9-yl)-1,1,3,3-tetramethyl-2H-indene-5-carbonitrile.
| Compound Name | 7-bis(2,6-dimethylphenyl)boranyl-4,6-bis(3,6-diphenylcarbazol-9-yl)-1,1,3,3-tetramethyl-2H-indene-5-carbonitrile |
|---|---|
| PubChem CID | 123923749 |
| Molecular Formula | C78H64BN3 |
| Molecular Weight | 1054.20 g/mol |
| Exact Mass | 1053.52 |
| IUPAC Name | 7-bis(2,6-dimethylphenyl)boranyl-4,6-bis(3,6-diphenylcarbazol-9-yl)-1,1,3,3-tetramethyl-2H-indene-5-carbonitrile |
| SMILES | Cc1cccc(C)c1B(c1c(C)cccc1C)c1c(-n2c3ccc(-c4ccccc4)cc3c3cc(-c4ccccc4)ccc32)c(C#N)c(-n2c3ccc(-c4ccccc4)cc3c3cc(-c4ccccc4)ccc32)c2c1C(C)(C)CC2(C)C |
| InChI | InChI=1S/C78H64BN3/c1-49-23-21-24-50(2)72(49)79(73-51(3)25-22-26-52(73)4)74-70-71(78(7,8)48-77(70,5)6)75(81-66-39-35-57(53-27-13-9-14-28-53)43-61(66)62-44-58(36-40-67(62)81)54-29-15-10-16-30-54)65(47-80)76(74)82-68-41-37-59(55-31-17-11-18-32-55)45-63(68)64-46-60(38-42-69(64)82)56-33-19-12-20-34-56/h9-46H,48H2,1-8H3 |
| InChIKey | VIADCIYFWDOFHF-UHFFFAOYSA-N |
| XLogP | 18.13 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1054.20 |
| LogP ≤ 5 | 18.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|