C48H34N6O — CID 122607642
1,1,3,3-tetramethyl-5,6-bis(6-phenylpyrido[3,4-b]indol-9-yl)-2-benzofuran-4,7-dicarbonitrile (PubChem CID 122607642) has the molecular formula C48H34N6O and a molecular weight of 710.84 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-5,6-bis(6-phenylpyrido[3,4-b]indol-9-yl)-2-benzofuran-4,7-dicarbonitrile.
| Compound Name | 1,1,3,3-tetramethyl-5,6-bis(6-phenylpyrido[3,4-b]indol-9-yl)-2-benzofuran-4,7-dicarbonitrile |
|---|---|
| PubChem CID | 122607642 |
| Molecular Formula | C48H34N6O |
| Molecular Weight | 710.84 g/mol |
| Exact Mass | 710.28 |
| IUPAC Name | 1,1,3,3-tetramethyl-5,6-bis(6-phenylpyrido[3,4-b]indol-9-yl)-2-benzofuran-4,7-dicarbonitrile |
| SMILES | CC1(C)OC(C)(C)c2c(C#N)c(-n3c4ccc(-c5ccccc5)cc4c4ccncc43)c(-n3c4ccc(-c5ccccc5)cc4c4ccncc43)c(C#N)c21 |
| InChI | InChI=1S/C48H34N6O/c1-47(2)43-37(25-49)45(53-39-17-15-31(29-11-7-5-8-12-29)23-35(39)33-19-21-51-27-41(33)53)46(38(26-50)44(43)48(3,4)55-47)54-40-18-16-32(30-13-9-6-10-14-30)24-36(40)34-20-22-52-28-42(34)54/h5-24,27-28H,1-4H3 |
| InChIKey | LCEMHJBAYPJORC-UHFFFAOYSA-N |
| XLogP | 11.25 |
| TPSA | 92.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.84 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |