C38H22F4N4 — CID 122609811
7-(3,6-diphenylcarbazol-9-yl)-1,1,3,3-tetrafluoro-2,2-dimethylindene-4,5,6-tricarbonitrile (PubChem CID 122609811) has the molecular formula C38H22F4N4 and a molecular weight of 610.61 g/mol. Its IUPAC name is 7-(3,6-diphenylcarbazol-9-yl)-1,1,3,3-tetrafluoro-2,2-dimethylindene-4,5,6-tricarbonitrile.
| Compound Name | 7-(3,6-diphenylcarbazol-9-yl)-1,1,3,3-tetrafluoro-2,2-dimethylindene-4,5,6-tricarbonitrile |
|---|---|
| PubChem CID | 122609811 |
| Molecular Formula | C38H22F4N4 |
| Molecular Weight | 610.61 g/mol |
| Exact Mass | 610.18 |
| IUPAC Name | 7-(3,6-diphenylcarbazol-9-yl)-1,1,3,3-tetrafluoro-2,2-dimethylindene-4,5,6-tricarbonitrile |
| SMILES | CC1(C)C(F)(F)c2c(C#N)c(C#N)c(C#N)c(-n3c4ccc(-c5ccccc5)cc4c4cc(-c5ccccc5)ccc43)c2C1(F)F |
| InChI | InChI=1S/C38H22F4N4/c1-36(2)37(39,40)33-29(20-44)28(19-43)30(21-45)35(34(33)38(36,41)42)46-31-15-13-24(22-9-5-3-6-10-22)17-26(31)27-18-25(14-16-32(27)46)23-11-7-4-8-12-23/h3-18H,1-2H3 |
| InChIKey | MPEMCKCVLKQCEK-UHFFFAOYSA-N |
| XLogP | 9.96 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.61 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |