C95H80N4 — CID 122607612
5,6,7-tris(9,9-dimethyl-2,7-diphenylacridin-10-yl)-1,1,3,3-tetramethyl-2H-indene-4-carbonitrile (PubChem CID 122607612) has the molecular formula C95H80N4 and a molecular weight of 1277.71 g/mol. Its IUPAC name is 5,6,7-tris(9,9-dimethyl-2,7-diphenylacridin-10-yl)-1,1,3,3-tetramethyl-2H-indene-4-carbonitrile.
| Compound Name | 5,6,7-tris(9,9-dimethyl-2,7-diphenylacridin-10-yl)-1,1,3,3-tetramethyl-2H-indene-4-carbonitrile |
|---|---|
| PubChem CID | 122607612 |
| Molecular Formula | C95H80N4 |
| Molecular Weight | 1277.71 g/mol |
| Exact Mass | 1276.64 |
| IUPAC Name | 5,6,7-tris(9,9-dimethyl-2,7-diphenylacridin-10-yl)-1,1,3,3-tetramethyl-2H-indene-4-carbonitrile |
| SMILES | CC1(C)CC(C)(C)c2c(N3c4ccc(-c5ccccc5)cc4C(C)(C)c4cc(-c5ccccc5)ccc43)c(N3c4ccc(-c5ccccc5)cc4C(C)(C)c4cc(-c5ccccc5)ccc43)c(N3c4ccc(-c5ccccc5)cc4C(C)(C)c4cc(-c5ccccc5)ccc43)c(C#N)c21 |
| InChI | InChI=1S/C95H80N4/c1-91(2)60-92(3,4)87-86(91)73(59-96)88(97-80-47-41-67(61-29-17-11-18-30-61)53-74(80)93(5,6)75-54-68(42-48-81(75)97)62-31-19-12-20-32-62)90(99-84-51-45-71(65-37-25-15-26-38-65)57-78(84)95(9,10)79-58-72(46-52-85(79)99)66-39-27-16-28-40-66)89(87)98-82-49-43-69(63-33-21-13-22-34-63)55-76(82)94(7,8)77-56-70(44-50-83(77)98)64-35-23-14-24-36-64/h11-58H,60H2,1-10H3 |
| InChIKey | RHQFHKANVZLAKO-UHFFFAOYSA-N |
| XLogP | 25.85 |
| TPSA | 33.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 99 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1277.71 |
| LogP ≤ 5 | 25.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |