C67H50F4N4 — CID 140745744
4,6-bis(9,9-dimethyl-2,7-diphenylacridin-10-yl)-1,1,3,3-tetrafluoro-7-isocyano-2,2-dimethylindene-5-carbonitrile (PubChem CID 140745744) has the molecular formula C67H50F4N4 and a molecular weight of 987.16 g/mol. Its IUPAC name is 4,6-bis(9,9-dimethyl-2,7-diphenylacridin-10-yl)-1,1,3,3-tetrafluoro-7-isocyano-2,2-dimethylindene-5-carbonitrile.
| Compound Name | 4,6-bis(9,9-dimethyl-2,7-diphenylacridin-10-yl)-1,1,3,3-tetrafluoro-7-isocyano-2,2-dimethylindene-5-carbonitrile |
|---|---|
| PubChem CID | 140745744 |
| Molecular Formula | C67H50F4N4 |
| Molecular Weight | 987.16 g/mol |
| Exact Mass | 986.40 |
| IUPAC Name | 4,6-bis(9,9-dimethyl-2,7-diphenylacridin-10-yl)-1,1,3,3-tetrafluoro-7-isocyano-2,2-dimethylindene-5-carbonitrile |
| SMILES | [C-]#[N+]c1c(N2c3ccc(-c4ccccc4)cc3C(C)(C)c3cc(-c4ccccc4)ccc32)c(C#N)c(N2c3ccc(-c4ccccc4)cc3C(C)(C)c3cc(-c4ccccc4)ccc32)c2c1C(F)(F)C(C)(C)C2(F)F |
| InChI | InChI=1S/C67H50F4N4/c1-63(2)50-36-45(41-20-12-8-13-21-41)28-32-54(50)74(55-33-29-46(37-51(55)63)42-22-14-9-15-23-42)61-49(40-72)62(60(73-7)58-59(61)67(70,71)65(5,6)66(58,68)69)75-56-34-30-47(43-24-16-10-17-25-43)38-52(56)64(3,4)53-39-48(31-35-57(53)75)44-26-18-11-19-27-44/h8-39H,1-6H3 |
| InChIKey | DSYQZWSJFVOPFQ-UHFFFAOYSA-N |
| XLogP | 19.22 |
| TPSA | 34.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 987.16 |
| LogP ≤ 5 | 19.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|