C41H32N6 — CID 122609940
6-[10-(2,6-dimethylphenyl)-8-phenylpyrido[4,3-b]quinoxalin-5-yl]-1,8-dimethyltricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-3,4,5-tricarbonitrile (PubChem CID 122609940) has the molecular formula C41H32N6 and a molecular weight of 608.75 g/mol. Its IUPAC name is 6-[10-(2,6-dimethylphenyl)-8-phenylpyrido[4,3-b]quinoxalin-5-yl]-1,8-dimethyltricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-3,4,5-tricarbonitrile.
| Compound Name | 6-[10-(2,6-dimethylphenyl)-8-phenylpyrido[4,3-b]quinoxalin-5-yl]-1,8-dimethyltricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-3,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 122609940 |
| Molecular Formula | C41H32N6 |
| Molecular Weight | 608.75 g/mol |
| Exact Mass | 608.27 |
| IUPAC Name | 6-[10-(2,6-dimethylphenyl)-8-phenylpyrido[4,3-b]quinoxalin-5-yl]-1,8-dimethyltricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-3,4,5-tricarbonitrile |
| SMILES | Cc1cccc(C)c1N1c2cnccc2N(c2c(C#N)c(C#N)c(C#N)c3c2C2(C)CCC3(C)C2)c2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C41H32N6/c1-25-9-8-10-26(2)38(25)47-34-19-28(27-11-6-5-7-12-27)13-14-32(34)46(33-15-18-45-23-35(33)47)39-31(22-44)29(20-42)30(21-43)36-37(39)41(4)17-16-40(36,3)24-41/h5-15,18-19,23H,16-17,24H2,1-4H3 |
| InChIKey | RTSHYACYZABIQX-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 90.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.75 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |