C56H34N2O3S — CID 140711796
3-[7'-[4-(benzenesulfonyl)phenyl]spiro[fluorene-9,9'-xanthene]-2'-yl]-6-isocyano-9-phenylcarbazole (PubChem CID 140711796) has the molecular formula C56H34N2O3S and a molecular weight of 814.97 g/mol. Its IUPAC name is 3-[7'-[4-(benzenesulfonyl)phenyl]spiro[fluorene-9,9'-xanthene]-2'-yl]-6-isocyano-9-phenylcarbazole.
| Compound Name | 3-[7'-[4-(benzenesulfonyl)phenyl]spiro[fluorene-9,9'-xanthene]-2'-yl]-6-isocyano-9-phenylcarbazole |
|---|---|
| PubChem CID | 140711796 |
| Molecular Formula | C56H34N2O3S |
| Molecular Weight | 814.97 g/mol |
| Exact Mass | 814.23 |
| IUPAC Name | 3-[7'-[4-(benzenesulfonyl)phenyl]spiro[fluorene-9,9'-xanthene]-2'-yl]-6-isocyano-9-phenylcarbazole |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cc(-c3ccc4c(c3)C3(c5cc(-c6ccc(S(=O)(=O)c7ccccc7)cc6)ccc5O4)c4ccccc4-c4ccccc43)ccc1n2-c1ccccc1 |
| InChI | InChI=1S/C56H34N2O3S/c1-57-40-25-29-53-47(35-40)46-32-37(22-28-52(46)58(53)41-12-4-2-5-13-41)39-24-31-55-51(34-39)56(48-18-10-8-16-44(48)45-17-9-11-19-49(45)56)50-33-38(23-30-54(50)61-55)36-20-26-43(27-21-36)62(59,60)42-14-6-3-7-15-42/h2-35H |
| InChIKey | QGRSYLTWQFUKKL-UHFFFAOYSA-N |
| XLogP | 13.97 |
| TPSA | 52.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.97 |
| LogP ≤ 5 | 13.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|