C38H23NO — CID 140947310
2'-[3-(3-isocyanophenyl)phenyl]spiro[fluorene-9,9'-xanthene] (PubChem CID 140947310) has the molecular formula C38H23NO and a molecular weight of 509.61 g/mol. Its IUPAC name is 2'-[3-(3-isocyanophenyl)phenyl]spiro[fluorene-9,9'-xanthene].
| Compound Name | 2'-[3-(3-isocyanophenyl)phenyl]spiro[fluorene-9,9'-xanthene] |
|---|---|
| PubChem CID | 140947310 |
| Molecular Formula | C38H23NO |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | 2'-[3-(3-isocyanophenyl)phenyl]spiro[fluorene-9,9'-xanthene] |
| SMILES | [C-]#[N+]c1cccc(-c2cccc(-c3ccc4c(c3)C3(c5ccccc5O4)c4ccccc4-c4ccccc43)c2)c1 |
| InChI | InChI=1S/C38H23NO/c1-39-29-13-9-12-27(23-29)25-10-8-11-26(22-25)28-20-21-37-35(24-28)38(34-18-6-7-19-36(34)40-37)32-16-4-2-14-30(32)31-15-3-5-17-33(31)38/h2-24H |
| InChIKey | IHXUGPRNUVRQSW-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 13.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|