C41H27NO — CID 160966397
5-(3-isocyanophenyl)-14-(3-methylphenyl)spiro[tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene-2,9'-xanthene] (PubChem CID 160966397) has the molecular formula C41H27NO and a molecular weight of 549.67 g/mol. Its IUPAC name is 5-(3-isocyanophenyl)-14-(3-methylphenyl)spiro[tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene-2,9'-xanthene].
| Compound Name | 5-(3-isocyanophenyl)-14-(3-methylphenyl)spiro[tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene-2,9'-xanthene] |
|---|---|
| PubChem CID | 160966397 |
| Molecular Formula | C41H27NO |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.21 |
| IUPAC Name | 5-(3-isocyanophenyl)-14-(3-methylphenyl)spiro[tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene-2,9'-xanthene] |
| SMILES | [C-]#[N+]c1cccc(-c2ccc3c(c2)C2(c4cc(-c5cccc(C)c5)ccc4C=C3)c3ccccc3Oc3ccccc32)c1 |
| InChI | InChI=1S/C41H27NO/c1-27-9-7-10-30(23-27)32-21-19-28-17-18-29-20-22-33(31-11-8-12-34(24-31)42-2)26-38(29)41(37(28)25-32)35-13-3-5-15-39(35)43-40-16-6-4-14-36(40)41/h3-26H,1H3 |
| InChIKey | KGCRXAXXQJMSPO-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 13.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|