C45H31N3O — CID 154626511
4-[3-[7-(4-isocyanophenyl)spiro[fluorene-9,9'-xanthene]-2-yl]phenyl]-2,5,6-trimethylpyrimidine (PubChem CID 154626511) has the molecular formula C45H31N3O and a molecular weight of 629.76 g/mol. Its IUPAC name is 4-[3-[7-(4-isocyanophenyl)spiro[fluorene-9,9'-xanthene]-2-yl]phenyl]-2,5,6-trimethylpyrimidine.
| Compound Name | 4-[3-[7-(4-isocyanophenyl)spiro[fluorene-9,9'-xanthene]-2-yl]phenyl]-2,5,6-trimethylpyrimidine |
|---|---|
| PubChem CID | 154626511 |
| Molecular Formula | C45H31N3O |
| Molecular Weight | 629.76 g/mol |
| Exact Mass | 629.25 |
| IUPAC Name | 4-[3-[7-(4-isocyanophenyl)spiro[fluorene-9,9'-xanthene]-2-yl]phenyl]-2,5,6-trimethylpyrimidine |
| SMILES | [C-]#[N+]c1ccc(-c2ccc3c(c2)C2(c4ccccc4Oc4ccccc42)c2cc(-c4cccc(-c5nc(C)nc(C)c5C)c4)ccc2-3)cc1 |
| InChI | InChI=1S/C45H31N3O/c1-27-28(2)47-29(3)48-44(27)34-11-9-10-31(24-34)33-19-23-37-36-22-18-32(30-16-20-35(46-4)21-17-30)25-40(36)45(41(37)26-33)38-12-5-7-14-42(38)49-43-15-8-6-13-39(43)45/h5-26H,1-3H3 |
| InChIKey | RDEUEMLABMHJSI-UHFFFAOYSA-N |
| XLogP | 11.42 |
| TPSA | 39.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.76 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|