C60H37N4O+ — CID 140711788
3-[6'-(4,6-diphenylpyrimidin-1-ium-1-yl)spiro[fluorene-9,9'-xanthene]-2'-yl]-6-isocyano-9-phenylcarbazole (PubChem CID 140711788) has the molecular formula C60H37N4O+ and a molecular weight of 829.98 g/mol. Its IUPAC name is 3-[6'-(4,6-diphenylpyrimidin-1-ium-1-yl)spiro[fluorene-9,9'-xanthene]-2'-yl]-6-isocyano-9-phenylcarbazole.
| Compound Name | 3-[6'-(4,6-diphenylpyrimidin-1-ium-1-yl)spiro[fluorene-9,9'-xanthene]-2'-yl]-6-isocyano-9-phenylcarbazole |
|---|---|
| PubChem CID | 140711788 |
| Molecular Formula | C60H37N4O+ |
| Molecular Weight | 829.98 g/mol |
| Exact Mass | 829.30 |
| IUPAC Name | 3-[6'-(4,6-diphenylpyrimidin-1-ium-1-yl)spiro[fluorene-9,9'-xanthene]-2'-yl]-6-isocyano-9-phenylcarbazole |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cc(-c3ccc4c(c3)C3(c5ccc(-[n+]6cnc(-c7ccccc7)cc6-c6ccccc6)cc5O4)c4ccccc4-c4ccccc43)ccc1n2-c1ccccc1 |
| InChI | InChI=1S/C60H37N4O/c1-61-43-27-31-56-49(35-43)48-33-41(25-30-55(48)64(56)44-19-9-4-10-20-44)42-26-32-58-53(34-42)60(50-23-13-11-21-46(50)47-22-12-14-24-51(47)60)52-29-28-45(36-59(52)65-58)63-38-62-54(39-15-5-2-6-16-39)37-57(63)40-17-7-3-8-18-40/h2-38H/q+1 |
| InChIKey | UZHXSLZPEIZYLQ-UHFFFAOYSA-N |
| XLogP | 14.48 |
| TPSA | 35.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.98 |
| LogP ≤ 5 | 14.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|