C43H27N3O — CID 140711735
3-(9,9-diphenylxanthen-2-yl)-6-isocyano-9-pyridin-3-ylcarbazole (PubChem CID 140711735) has the molecular formula C43H27N3O and a molecular weight of 601.71 g/mol. Its IUPAC name is 3-(9,9-diphenylxanthen-2-yl)-6-isocyano-9-pyridin-3-ylcarbazole.
| Compound Name | 3-(9,9-diphenylxanthen-2-yl)-6-isocyano-9-pyridin-3-ylcarbazole |
|---|---|
| PubChem CID | 140711735 |
| Molecular Formula | C43H27N3O |
| Molecular Weight | 601.71 g/mol |
| Exact Mass | 601.22 |
| IUPAC Name | 3-(9,9-diphenylxanthen-2-yl)-6-isocyano-9-pyridin-3-ylcarbazole |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cc(-c3ccc4c(c3)C(c3ccccc3)(c3ccccc3)c3ccccc3O4)ccc1n2-c1cccnc1 |
| InChI | InChI=1S/C43H27N3O/c1-44-33-20-22-40-36(27-33)35-25-29(18-21-39(35)46(40)34-15-10-24-45-28-34)30-19-23-42-38(26-30)43(31-11-4-2-5-12-31,32-13-6-3-7-14-32)37-16-8-9-17-41(37)47-42/h2-28H |
| InChIKey | GWIVGGIOYUCRJW-UHFFFAOYSA-N |
| XLogP | 10.88 |
| TPSA | 31.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.71 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|