C50H31N3 — CID 123347422
3-(2,6-diphenyl-10-pyridin-3-ylanthracen-9-yl)-6-isocyano-9-phenylcarbazole (PubChem CID 123347422) has the molecular formula C50H31N3 and a molecular weight of 673.82 g/mol. Its IUPAC name is 3-(2,6-diphenyl-10-pyridin-3-ylanthracen-9-yl)-6-isocyano-9-phenylcarbazole.
| Compound Name | 3-(2,6-diphenyl-10-pyridin-3-ylanthracen-9-yl)-6-isocyano-9-phenylcarbazole |
|---|---|
| PubChem CID | 123347422 |
| Molecular Formula | C50H31N3 |
| Molecular Weight | 673.82 g/mol |
| Exact Mass | 673.25 |
| IUPAC Name | 3-(2,6-diphenyl-10-pyridin-3-ylanthracen-9-yl)-6-isocyano-9-phenylcarbazole |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cc(-c3c4ccc(-c5ccccc5)cc4c(-c4cccnc4)c4ccc(-c5ccccc5)cc34)ccc1n2-c1ccccc1 |
| InChI | InChI=1S/C50H31N3/c1-51-39-22-26-48-44(31-39)43-30-37(21-25-47(43)53(48)40-17-9-4-10-18-40)49-41-23-19-36(34-14-7-3-8-15-34)29-46(41)50(38-16-11-27-52-32-38)42-24-20-35(28-45(42)49)33-12-5-2-6-13-33/h2-32H |
| InChIKey | AHAHEYGFGJKAGH-UHFFFAOYSA-N |
| XLogP | 13.70 |
| TPSA | 22.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.82 |
| LogP ≤ 5 | 13.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|