C40H27N3 — CID 123301938
3-(2,6-dimethyl-10-pyridin-4-ylanthracen-9-yl)-6-isocyano-9-phenylcarbazole (PubChem CID 123301938) has the molecular formula C40H27N3 and a molecular weight of 549.68 g/mol. Its IUPAC name is 3-(2,6-dimethyl-10-pyridin-4-ylanthracen-9-yl)-6-isocyano-9-phenylcarbazole.
| Compound Name | 3-(2,6-dimethyl-10-pyridin-4-ylanthracen-9-yl)-6-isocyano-9-phenylcarbazole |
|---|---|
| PubChem CID | 123301938 |
| Molecular Formula | C40H27N3 |
| Molecular Weight | 549.68 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | 3-(2,6-dimethyl-10-pyridin-4-ylanthracen-9-yl)-6-isocyano-9-phenylcarbazole |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cc(-c3c4ccc(C)cc4c(-c4ccncc4)c4ccc(C)cc34)ccc1n2-c1ccccc1 |
| InChI | InChI=1S/C40H27N3/c1-25-10-14-32-35(21-25)39(27-17-19-42-20-18-27)31-13-9-26(2)22-36(31)40(32)28-11-15-37-33(23-28)34-24-29(41-3)12-16-38(34)43(37)30-7-5-4-6-8-30/h4-24H,1-2H3 |
| InChIKey | FIFQKRSKMBVAQV-UHFFFAOYSA-N |
| XLogP | 10.99 |
| TPSA | 22.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.68 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|