C41H24N6 — CID 140725187
3,6-diisocyano-9-[4-[2-phenyl-6-(4-pyridin-3-ylphenyl)pyrimidin-4-yl]phenyl]carbazole (PubChem CID 140725187) has the molecular formula C41H24N6 and a molecular weight of 600.69 g/mol. Its IUPAC name is 3,6-diisocyano-9-[4-[2-phenyl-6-(4-pyridin-3-ylphenyl)pyrimidin-4-yl]phenyl]carbazole.
| Compound Name | 3,6-diisocyano-9-[4-[2-phenyl-6-(4-pyridin-3-ylphenyl)pyrimidin-4-yl]phenyl]carbazole |
|---|---|
| PubChem CID | 140725187 |
| Molecular Formula | C41H24N6 |
| Molecular Weight | 600.69 g/mol |
| Exact Mass | 600.21 |
| IUPAC Name | 3,6-diisocyano-9-[4-[2-phenyl-6-(4-pyridin-3-ylphenyl)pyrimidin-4-yl]phenyl]carbazole |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cc([N+]#[C-])ccc1n2-c1ccc(-c2cc(-c3ccc(-c4cccnc4)cc3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C41H24N6/c1-42-32-16-20-39-35(23-32)36-24-33(43-2)17-21-40(36)47(39)34-18-14-29(15-19-34)38-25-37(45-41(46-38)30-7-4-3-5-8-30)28-12-10-27(11-13-28)31-9-6-22-44-26-31/h3-26H |
| InChIKey | XCGPNDKOQRGFCL-UHFFFAOYSA-N |
| XLogP | 10.74 |
| TPSA | 52.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.69 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|