C35H18F4N4O — CID 140745822
1,1,3,3-tetrafluoro-6,7-diisocyano-5-(4-phenyl-N-(4-phenylphenyl)anilino)-2-benzofuran-4-carbonitrile (PubChem CID 140745822) has the molecular formula C35H18F4N4O and a molecular weight of 586.55 g/mol. Its IUPAC name is 1,1,3,3-tetrafluoro-6,7-diisocyano-5-(4-phenyl-N-(4-phenylphenyl)anilino)-2-benzofuran-4-carbonitrile.
| Compound Name | 1,1,3,3-tetrafluoro-6,7-diisocyano-5-(4-phenyl-N-(4-phenylphenyl)anilino)-2-benzofuran-4-carbonitrile |
|---|---|
| PubChem CID | 140745822 |
| Molecular Formula | C35H18F4N4O |
| Molecular Weight | 586.55 g/mol |
| Exact Mass | 586.14 |
| IUPAC Name | 1,1,3,3-tetrafluoro-6,7-diisocyano-5-(4-phenyl-N-(4-phenylphenyl)anilino)-2-benzofuran-4-carbonitrile |
| SMILES | [C-]#[N+]c1c([N+]#[C-])c2c(c(C#N)c1N(c1ccc(-c3ccccc3)cc1)c1ccc(-c3ccccc3)cc1)C(F)(F)OC2(F)F |
| InChI | InChI=1S/C35H18F4N4O/c1-41-31-30-29(34(36,37)44-35(30,38)39)28(21-40)33(32(31)42-2)43(26-17-13-24(14-18-26)22-9-5-3-6-10-22)27-19-15-25(16-20-27)23-11-7-4-8-12-23/h3-20H |
| InChIKey | VFDQSHYWPZGEJB-UHFFFAOYSA-N |
| XLogP | 10.59 |
| TPSA | 44.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.55 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|