C64H43N5 — CID 140917277
4-(4-benzhydrylphenyl)-5-isocyano-2,6-bis[4-(N-phenylanilino)phenyl]benzene-1,3-dicarbonitrile (PubChem CID 140917277) has the molecular formula C64H43N5 and a molecular weight of 882.08 g/mol. Its IUPAC name is 4-(4-benzhydrylphenyl)-5-isocyano-2,6-bis[4-(N-phenylanilino)phenyl]benzene-1,3-dicarbonitrile.
| Compound Name | 4-(4-benzhydrylphenyl)-5-isocyano-2,6-bis[4-(N-phenylanilino)phenyl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 140917277 |
| Molecular Formula | C64H43N5 |
| Molecular Weight | 882.08 g/mol |
| Exact Mass | 881.35 |
| IUPAC Name | 4-(4-benzhydrylphenyl)-5-isocyano-2,6-bis[4-(N-phenylanilino)phenyl]benzene-1,3-dicarbonitrile |
| SMILES | [C-]#[N+]c1c(-c2ccc(C(c3ccccc3)c3ccccc3)cc2)c(C#N)c(-c2ccc(N(c3ccccc3)c3ccccc3)cc2)c(C#N)c1-c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C64H43N5/c1-67-64-62(50-34-32-48(33-35-50)60(46-20-8-2-9-21-46)47-22-10-3-11-23-47)58(44-65)61(49-36-40-56(41-37-49)68(52-24-12-4-13-25-52)53-26-14-5-15-27-53)59(45-66)63(64)51-38-42-57(43-39-51)69(54-28-16-6-17-29-54)55-30-18-7-19-31-55/h2-43,60H |
| InChIKey | DPNAULHZUMBVJM-UHFFFAOYSA-N |
| XLogP | 17.10 |
| TPSA | 58.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.08 |
| LogP ≤ 5 | 17.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|