C52H42F10N2 — CID 88871273
1-N,6-N-bis[4-(2,2,3,3,3-pentafluoropropyl)phenyl]-1-N,6-N-diphenyl-3,8-di(propan-2-yl)pyrene-1,6-diamine (PubChem CID 88871273) has the molecular formula C52H42F10N2 and a molecular weight of 884.90 g/mol. Its IUPAC name is 1-N,6-N-bis[4-(2,2,3,3,3-pentafluoropropyl)phenyl]-1-N,6-N-diphenyl-3,8-di(propan-2-yl)pyrene-1,6-diamine.
| Compound Name | 1-N,6-N-bis[4-(2,2,3,3,3-pentafluoropropyl)phenyl]-1-N,6-N-diphenyl-3,8-di(propan-2-yl)pyrene-1,6-diamine |
|---|---|
| PubChem CID | 88871273 |
| Molecular Formula | C52H42F10N2 |
| Molecular Weight | 884.90 g/mol |
| Exact Mass | 884.32 |
| IUPAC Name | 1-N,6-N-bis[4-(2,2,3,3,3-pentafluoropropyl)phenyl]-1-N,6-N-diphenyl-3,8-di(propan-2-yl)pyrene-1,6-diamine |
| SMILES | CC(C)c1cc(N(c2ccccc2)c2ccc(CC(F)(F)C(F)(F)F)cc2)c2ccc3c(C(C)C)cc(N(c4ccccc4)c4ccc(CC(F)(F)C(F)(F)F)cc4)c4ccc1c2c34 |
| InChI | InChI=1S/C52H42F10N2/c1-31(2)43-27-45(63(35-11-7-5-8-12-35)37-19-15-33(16-20-37)29-49(53,54)51(57,58)59)41-26-24-40-44(32(3)4)28-46(42-25-23-39(43)47(41)48(40)42)64(36-13-9-6-10-14-36)38-21-17-34(18-22-38)30-50(55,56)52(60,61)62/h5-28,31-32H,29-30H2,1-4H3 |
| InChIKey | IGBACJJFULQBEK-UHFFFAOYSA-N |
| XLogP | 17.25 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.90 |
| LogP ≤ 5 | 17.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|