C84H90N8 — CID 176876788
1-N,3-N,6-N,8-N-tetrakis(4-tert-butylphenyl)-1-N,3-N,6-N,8-N-tetrakis(2,4-dimethyl-3-pyridinyl)pyrene-1,3,6,8-tetramine (PubChem CID 176876788) has the molecular formula C84H90N8 and a molecular weight of 1211.70 g/mol. Its IUPAC name is 1-N,3-N,6-N,8-N-tetrakis(4-tert-butylphenyl)-1-N,3-N,6-N,8-N-tetrakis(2,4-dimethyl-3-pyridinyl)pyrene-1,3,6,8-tetramine.
| Compound Name | 1-N,3-N,6-N,8-N-tetrakis(4-tert-butylphenyl)-1-N,3-N,6-N,8-N-tetrakis(2,4-dimethyl-3-pyridinyl)pyrene-1,3,6,8-tetramine |
|---|---|
| PubChem CID | 176876788 |
| Molecular Formula | C84H90N8 |
| Molecular Weight | 1211.70 g/mol |
| Exact Mass | 1210.73 |
| IUPAC Name | 1-N,3-N,6-N,8-N-tetrakis(4-tert-butylphenyl)-1-N,3-N,6-N,8-N-tetrakis(2,4-dimethyl-3-pyridinyl)pyrene-1,3,6,8-tetramine |
| SMILES | Cc1ccnc(C)c1N(c1ccc(C(C)(C)C)cc1)c1cc(N(c2ccc(C(C)(C)C)cc2)c2c(C)ccnc2C)c2ccc3c(N(c4ccc(C(C)(C)C)cc4)c4c(C)ccnc4C)cc(N(c4ccc(C(C)(C)C)cc4)c4c(C)ccnc4C)c4ccc1c2c43 |
| InChI | InChI=1S/C84H90N8/c1-51-41-45-85-55(5)77(51)89(63-29-21-59(22-30-63)81(9,10)11)71-49-72(90(78-52(2)42-46-86-56(78)6)64-31-23-60(24-32-64)82(12,13)14)68-39-40-70-74(92(80-54(4)44-48-88-58(80)8)66-35-27-62(28-36-66)84(18,19)20)50-73(69-38-37-67(71)75(68)76(69)70)91(79-53(3)43-47-87-57(79)7)65-33-25-61(26-34-65)83(15,16)17/h21-50H,1-20H3 |
| InChIKey | CVKPSRZPBVUBJD-UHFFFAOYSA-N |
| XLogP | 23.70 |
| TPSA | 64.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 92 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1211.70 |
| LogP ≤ 5 | 23.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|