C40H41N3 — CID 141326767
N,N-bis(4-tert-butylphenyl)-4-(4,7-dimethyl-1,10-phenanthrolin-3-yl)aniline (PubChem CID 141326767) has the molecular formula C40H41N3 and a molecular weight of 563.79 g/mol. Its IUPAC name is N,N-bis(4-tert-butylphenyl)-4-(4,7-dimethyl-1,10-phenanthrolin-3-yl)aniline.
| Compound Name | N,N-bis(4-tert-butylphenyl)-4-(4,7-dimethyl-1,10-phenanthrolin-3-yl)aniline |
|---|---|
| PubChem CID | 141326767 |
| Molecular Formula | C40H41N3 |
| Molecular Weight | 563.79 g/mol |
| Exact Mass | 563.33 |
| IUPAC Name | N,N-bis(4-tert-butylphenyl)-4-(4,7-dimethyl-1,10-phenanthrolin-3-yl)aniline |
| SMILES | Cc1ccnc2c1ccc1c(C)c(-c3ccc(N(c4ccc(C(C)(C)C)cc4)c4ccc(C(C)(C)C)cc4)cc3)cnc12 |
| InChI | InChI=1S/C40H41N3/c1-26-23-24-41-37-34(26)21-22-35-27(2)36(25-42-38(35)37)28-9-15-31(16-10-28)43(32-17-11-29(12-18-32)39(3,4)5)33-19-13-30(14-20-33)40(6,7)8/h9-25H,1-8H3 |
| InChIKey | JLAMHOIDLBUZNM-UHFFFAOYSA-N |
| XLogP | 11.13 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.79 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|