C40H41N3O2 — CID 141326764
4-(4,7-dimethyl-1,10-phenanthrolin-3-yl)-N,N-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]aniline (PubChem CID 141326764) has the molecular formula C40H41N3O2 and a molecular weight of 595.79 g/mol. Its IUPAC name is 4-(4,7-dimethyl-1,10-phenanthrolin-3-yl)-N,N-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]aniline.
| Compound Name | 4-(4,7-dimethyl-1,10-phenanthrolin-3-yl)-N,N-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]aniline |
|---|---|
| PubChem CID | 141326764 |
| Molecular Formula | C40H41N3O2 |
| Molecular Weight | 595.79 g/mol |
| Exact Mass | 595.32 |
| IUPAC Name | 4-(4,7-dimethyl-1,10-phenanthrolin-3-yl)-N,N-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]aniline |
| SMILES | Cc1ccnc2c1ccc1c(C)c(-c3ccc(N(c4ccc(OC(C)(C)C)cc4)c4ccc(OC(C)(C)C)cc4)cc3)cnc12 |
| InChI | InChI=1S/C40H41N3O2/c1-26-23-24-41-37-34(26)21-22-35-27(2)36(25-42-38(35)37)28-9-11-29(12-10-28)43(30-13-17-32(18-14-30)44-39(3,4)5)31-15-19-33(20-16-31)45-40(6,7)8/h9-25H,1-8H3 |
| InChIKey | GZGFRTGWBIWDCR-UHFFFAOYSA-N |
| XLogP | 10.89 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.79 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|