C32H32N4O — CID 44532528
N',N'-dimethyl-N-[[3-[4-(4-phenoxyanilino)quinolin-7-yl]phenyl]methyl]ethane-1,2-diamine (PubChem CID 44532528) has the molecular formula C32H32N4O and a molecular weight of 488.64 g/mol. Its IUPAC name is N',N'-dimethyl-N-[[3-[4-(4-phenoxyanilino)quinolin-7-yl]phenyl]methyl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[[3-[4-(4-phenoxyanilino)quinolin-7-yl]phenyl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 44532528 |
| Molecular Formula | C32H32N4O |
| Molecular Weight | 488.64 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | N',N'-dimethyl-N-[[3-[4-(4-phenoxyanilino)quinolin-7-yl]phenyl]methyl]ethane-1,2-diamine |
| SMILES | CN(C)CCNCc1cccc(-c2ccc3c(Nc4ccc(Oc5ccccc5)cc4)ccnc3c2)c1 |
| InChI | InChI=1S/C32H32N4O/c1-36(2)20-19-33-23-24-7-6-8-25(21-24)26-11-16-30-31(17-18-34-32(30)22-26)35-27-12-14-29(15-13-27)37-28-9-4-3-5-10-28/h3-18,21-22,33H,19-20,23H2,1-2H3,(H,34,35) |
| InChIKey | UIHVBUQOGYCWAW-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 49.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.64 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|