C74H100N2 — CID 147772175
2-tert-butyl-9-N,9-N,10-N,10-N-tetrakis[3,5-di(butan-2-yl)phenyl]anthracene-9,10-diamine (PubChem CID 147772175) has the molecular formula C74H100N2 and a molecular weight of 1017.63 g/mol. Its IUPAC name is 2-tert-butyl-9-N,9-N,10-N,10-N-tetrakis[3,5-di(butan-2-yl)phenyl]anthracene-9,10-diamine.
| Compound Name | 2-tert-butyl-9-N,9-N,10-N,10-N-tetrakis[3,5-di(butan-2-yl)phenyl]anthracene-9,10-diamine |
|---|---|
| PubChem CID | 147772175 |
| Molecular Formula | C74H100N2 |
| Molecular Weight | 1017.63 g/mol |
| Exact Mass | 1016.79 |
| IUPAC Name | 2-tert-butyl-9-N,9-N,10-N,10-N-tetrakis[3,5-di(butan-2-yl)phenyl]anthracene-9,10-diamine |
| SMILES | CCC(C)c1cc(C(C)CC)cc(N(c2cc(C(C)CC)cc(C(C)CC)c2)c2c3ccccc3c(N(c3cc(C(C)CC)cc(C(C)CC)c3)c3cc(C(C)CC)cc(C(C)CC)c3)c3cc(C(C)(C)C)ccc23)c1 |
| InChI | InChI=1S/C74H100N2/c1-20-47(9)55-34-56(48(10)21-2)39-64(38-55)75(65-40-57(49(11)22-3)35-58(41-65)50(12)23-4)72-68-30-28-29-31-69(68)73(71-46-63(74(17,18)19)32-33-70(71)72)76(66-42-59(51(13)24-5)36-60(43-66)52(14)25-6)67-44-61(53(15)26-7)37-62(45-67)54(16)27-8/h28-54H,20-27H2,1-19H3 |
| InChIKey | HGDNFIBDRSRDLH-UHFFFAOYSA-N |
| XLogP | 24.34 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1017.63 |
| LogP ≤ 5 | 24.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|