C59H62N2 — CID 89058649
10-[4-(N-(4-butan-2-ylphenyl)anilino)phenyl]-2,6-ditert-butyl-N-phenyl-N-(4-propan-2-ylphenyl)anthracen-9-amine (PubChem CID 89058649) has the molecular formula C59H62N2 and a molecular weight of 799.16 g/mol. Its IUPAC name is 10-[4-(N-(4-butan-2-ylphenyl)anilino)phenyl]-2,6-ditert-butyl-N-phenyl-N-(4-propan-2-ylphenyl)anthracen-9-amine.
| Compound Name | 10-[4-(N-(4-butan-2-ylphenyl)anilino)phenyl]-2,6-ditert-butyl-N-phenyl-N-(4-propan-2-ylphenyl)anthracen-9-amine |
|---|---|
| PubChem CID | 89058649 |
| Molecular Formula | C59H62N2 |
| Molecular Weight | 799.16 g/mol |
| Exact Mass | 798.49 |
| IUPAC Name | 10-[4-(N-(4-butan-2-ylphenyl)anilino)phenyl]-2,6-ditert-butyl-N-phenyl-N-(4-propan-2-ylphenyl)anthracen-9-amine |
| SMILES | CCC(C)c1ccc(N(c2ccccc2)c2ccc(-c3c4cc(C(C)(C)C)ccc4c(N(c4ccccc4)c4ccc(C(C)C)cc4)c4cc(C(C)(C)C)ccc34)cc2)cc1 |
| InChI | InChI=1S/C59H62N2/c1-11-41(4)43-24-32-49(33-25-43)60(47-18-14-12-15-19-47)50-34-26-44(27-35-50)56-52-36-28-46(59(8,9)10)39-55(52)57(53-37-29-45(38-54(53)56)58(5,6)7)61(48-20-16-13-17-21-48)51-30-22-42(23-31-51)40(2)3/h12-41H,11H2,1-10H3 |
| InChIKey | QWMJQXVCMVCQAS-UHFFFAOYSA-N |
| XLogP | 17.83 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.16 |
| LogP ≤ 5 | 17.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|