C69H66N2 — CID 88885785
9-N-(4-butan-2-ylphenyl)-9-N,10-N,10-N-tris[4-(2-phenylpropan-2-yl)phenyl]anthracene-9,10-diamine (PubChem CID 88885785) has the molecular formula C69H66N2 and a molecular weight of 923.30 g/mol. Its IUPAC name is 9-N-(4-butan-2-ylphenyl)-9-N,10-N,10-N-tris[4-(2-phenylpropan-2-yl)phenyl]anthracene-9,10-diamine.
| Compound Name | 9-N-(4-butan-2-ylphenyl)-9-N,10-N,10-N-tris[4-(2-phenylpropan-2-yl)phenyl]anthracene-9,10-diamine |
|---|---|
| PubChem CID | 88885785 |
| Molecular Formula | C69H66N2 |
| Molecular Weight | 923.30 g/mol |
| Exact Mass | 922.52 |
| IUPAC Name | 9-N-(4-butan-2-ylphenyl)-9-N,10-N,10-N-tris[4-(2-phenylpropan-2-yl)phenyl]anthracene-9,10-diamine |
| SMILES | CCC(C)c1ccc(N(c2ccc(C(C)(C)c3ccccc3)cc2)c2c3ccccc3c(N(c3ccc(C(C)(C)c4ccccc4)cc3)c3ccc(C(C)(C)c4ccccc4)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C69H66N2/c1-9-49(2)50-33-41-57(42-34-50)70(58-43-35-54(36-44-58)67(3,4)51-23-13-10-14-24-51)65-61-29-19-21-31-63(61)66(64-32-22-20-30-62(64)65)71(59-45-37-55(38-46-59)68(5,6)52-25-15-11-16-26-52)60-47-39-56(40-48-60)69(7,8)53-27-17-12-18-28-53/h10-49H,9H2,1-8H3 |
| InChIKey | NFRWTRYVAGZMQE-UHFFFAOYSA-N |
| XLogP | 19.42 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.30 |
| LogP ≤ 5 | 19.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|