About 3-bromo-7,12-bis(4-tert-butylphenyl)benzo[k]fluoranthene
3-bromo-7,12-bis(4-tert-butylphenyl)benzo[k]fluoranthene (PubChem CID 67349188) has the molecular formula C40H35Br
and a molecular weight of 595.62 g/mol. Its IUPAC name is 3-bromo-7,12-bis(4-tert-butylphenyl)benzo[k]fluoranthene.
Molecular Properties
| Compound Name | 3-bromo-7,12-bis(4-tert-butylphenyl)benzo[k]fluoranthene |
| PubChem CID | 67349188 |
| Molecular Formula | C40H35Br |
| Molecular Weight | 595.62 g/mol |
| Exact Mass | 594.19 |
| IUPAC Name | 3-bromo-7,12-bis(4-tert-butylphenyl)benzo[k]fluoranthene |
| SMILES | CC(C)(C)c1ccc(-c2c3c(c(-c4ccc(C(C)(C)C)cc4)c4ccccc24)-c2ccc(Br)c4cccc-3c24)cc1 |
| InChI | InChI=1S/C40H35Br/c1-39(2,3)26-18-14-24(15-19-26)34-28-10-7-8-11-29(28)35(25-16-20-27(21-17-25)40(4,5)6)38-32-22-23-33(41)30-12-9-13-31(36(30)32)37(34)38/h7-23H,1-6H3 |
| InChIKey | HXAZVDJDQQVQSA-UHFFFAOYSA-N |
| XLogP | 12.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 595.62 |
| LogP ≤ 5 | 12.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-bromo-7,12-bis(4-tert-butylphenyl)benzo[k]fluoranthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-7,12-bis(4-tert-butylphenyl)benzo[k]fluoranthene?
The IUPAC name of 3-bromo-7,12-bis(4-tert-butylphenyl)benzo[k]fluoranthene (CID 67349188) is 3-bromo-7,12-bis(4-tert-butylphenyl)benzo[k]fluoranthene.
What is the SMILES notation for 3-bromo-7,12-bis(4-tert-butylphenyl)benzo[k]fluoranthene?
The canonical SMILES for 3-bromo-7,12-bis(4-tert-butylphenyl)benzo[k]fluoranthene is CC(C)(C)c1ccc(-c2c3c(c(-c4ccc(C(C)(C)C)cc4)c4ccccc24)-c2ccc(Br)c4cccc-3c24)cc1.
What is the InChIKey of 3-bromo-7,12-bis(4-tert-butylphenyl)benzo[k]fluoranthene?
The InChIKey is HXAZVDJDQQVQSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H35Br/c1-39(2,3)26-18-14-24(15-19-26)34-28-10-7-8-11-29(28)35(25-16-20-27(21-17-25)40(4,5)6)38-32-22-23-33(41)30-12-9-13-31(36(30)32)37(34)38/h7-23H,1-6H3.
What are the key properties of 3-bromo-7,12-bis(4-tert-butylphenyl)benzo[k]fluoranthene?
3-bromo-7,12-bis(4-tert-butylphenyl)benzo[k]fluoranthene has a molecular weight of 595.62 g/mol, XLogP of 12.33, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-7,12-bis(4-tert-butylphenyl)benzo[k]fluoranthene is sourced from PubChem (CID 67349188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).