C14H18F2 — CID 10966155
1,2-difluoro-3-[(E)-hept-1-enyl]-5-methylbenzene (PubChem CID 10966155) has the molecular formula C14H18F2 and a molecular weight of 224.29 g/mol. Its IUPAC name is 1,2-difluoro-3-[(E)-hept-1-enyl]-5-methylbenzene.
| Compound Name | 1,2-difluoro-3-[(E)-hept-1-enyl]-5-methylbenzene |
|---|---|
| PubChem CID | 10966155 |
| Molecular Formula | C14H18F2 |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 1,2-difluoro-3-[(E)-hept-1-enyl]-5-methylbenzene |
| SMILES | CCCCC/C=C/c1cc(C)cc(F)c1F |
| InChI | InChI=1S/C14H18F2/c1-3-4-5-6-7-8-12-9-11(2)10-13(15)14(12)16/h7-10H,3-6H2,1-2H3/b8-7+ |
| InChIKey | OINHMAULIJOADV-BQYQJAHWSA-N |
| XLogP | 4.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|