C27H34O8P+ — CID 173194926
[1-(2,6-diethoxybenzoyl)cyclohexyl]-oxo-(2,4,6-trimethoxybenzoyl)phosphanium (PubChem CID 173194926) has the molecular formula C27H34O8P+ and a molecular weight of 517.54 g/mol. Its IUPAC name is [1-(2,6-diethoxybenzoyl)cyclohexyl]-oxo-(2,4,6-trimethoxybenzoyl)phosphanium.
| Compound Name | [1-(2,6-diethoxybenzoyl)cyclohexyl]-oxo-(2,4,6-trimethoxybenzoyl)phosphanium |
|---|---|
| PubChem CID | 173194926 |
| Molecular Formula | C27H34O8P+ |
| Molecular Weight | 517.54 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | [1-(2,6-diethoxybenzoyl)cyclohexyl]-oxo-(2,4,6-trimethoxybenzoyl)phosphanium |
| SMILES | CCOc1cccc(OCC)c1C(=O)C1([P+](=O)C(=O)c2c(OC)cc(OC)cc2OC)CCCCC1 |
| InChI | InChI=1S/C27H34O8P/c1-6-34-19-12-11-13-20(35-7-2)23(19)25(28)27(14-9-8-10-15-27)36(30)26(29)24-21(32-4)16-18(31-3)17-22(24)33-5/h11-13,16-17H,6-10,14-15H2,1-5H3/q+1 |
| InChIKey | QNYFAKMQJMCXBP-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.54 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|