C23H20F6O5P+ — CID 173194985
[1-[2,6-bis(trifluoromethyl)benzoyl]cyclopentyl]-(2,6-dimethoxybenzoyl)-oxophosphanium (PubChem CID 173194985) has the molecular formula C23H20F6O5P+ and a molecular weight of 521.37 g/mol. Its IUPAC name is [1-[2,6-bis(trifluoromethyl)benzoyl]cyclopentyl]-(2,6-dimethoxybenzoyl)-oxophosphanium.
| Compound Name | [1-[2,6-bis(trifluoromethyl)benzoyl]cyclopentyl]-(2,6-dimethoxybenzoyl)-oxophosphanium |
|---|---|
| PubChem CID | 173194985 |
| Molecular Formula | C23H20F6O5P+ |
| Molecular Weight | 521.37 g/mol |
| Exact Mass | 521.09 |
| IUPAC Name | [1-[2,6-bis(trifluoromethyl)benzoyl]cyclopentyl]-(2,6-dimethoxybenzoyl)-oxophosphanium |
| SMILES | COc1cccc(OC)c1C(=O)[P+](=O)C1(C(=O)c2c(C(F)(F)F)cccc2C(F)(F)F)CCCC1 |
| InChI | InChI=1S/C23H20F6O5P/c1-33-15-9-6-10-16(34-2)18(15)20(31)35(32)21(11-3-4-12-21)19(30)17-13(22(24,25)26)7-5-8-14(17)23(27,28)29/h5-10H,3-4,11-12H2,1-2H3/q+1 |
| InChIKey | OKYLARLDJQVVTI-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.37 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|