C18H26O4P+ — CID 173194976
butan-2-yl-[1-(2,6-dimethoxybenzoyl)cyclopentyl]-oxophosphanium (PubChem CID 173194976) has the molecular formula C18H26O4P+ and a molecular weight of 337.38 g/mol. Its IUPAC name is butan-2-yl-[1-(2,6-dimethoxybenzoyl)cyclopentyl]-oxophosphanium.
| Compound Name | butan-2-yl-[1-(2,6-dimethoxybenzoyl)cyclopentyl]-oxophosphanium |
|---|---|
| PubChem CID | 173194976 |
| Molecular Formula | C18H26O4P+ |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | butan-2-yl-[1-(2,6-dimethoxybenzoyl)cyclopentyl]-oxophosphanium |
| SMILES | CCC(C)[P+](=O)C1(C(=O)c2c(OC)cccc2OC)CCCC1 |
| InChI | InChI=1S/C18H26O4P/c1-5-13(2)23(20)18(11-6-7-12-18)17(19)16-14(21-3)9-8-10-15(16)22-4/h8-10,13H,5-7,11-12H2,1-4H3/q+1 |
| InChIKey | BMHRFMLWRWJFGS-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|