C22H22Cl2O5P+ — CID 173195007
[1-(2,6-dichlorobenzoyl)cyclohexyl]-(2,6-dimethoxybenzoyl)-oxophosphanium (PubChem CID 173195007) has the molecular formula C22H22Cl2O5P+ and a molecular weight of 468.29 g/mol. Its IUPAC name is [1-(2,6-dichlorobenzoyl)cyclohexyl]-(2,6-dimethoxybenzoyl)-oxophosphanium.
| Compound Name | [1-(2,6-dichlorobenzoyl)cyclohexyl]-(2,6-dimethoxybenzoyl)-oxophosphanium |
|---|---|
| PubChem CID | 173195007 |
| Molecular Formula | C22H22Cl2O5P+ |
| Molecular Weight | 468.29 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | [1-(2,6-dichlorobenzoyl)cyclohexyl]-(2,6-dimethoxybenzoyl)-oxophosphanium |
| SMILES | COc1cccc(OC)c1C(=O)[P+](=O)C1(C(=O)c2c(Cl)cccc2Cl)CCCCC1 |
| InChI | InChI=1S/C22H22Cl2O5P/c1-28-16-10-7-11-17(29-2)19(16)21(26)30(27)22(12-4-3-5-13-22)20(25)18-14(23)8-6-9-15(18)24/h6-11H,3-5,12-13H2,1-2H3/q+1 |
| InChIKey | JNWXXFOOTUDRGA-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.29 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|