C10H9ClF2O2 — CID 131187635
1-(2-chloro-6-methoxyphenyl)-2,2-difluoropropan-1-one (PubChem CID 131187635) has the molecular formula C10H9ClF2O2 and a molecular weight of 234.63 g/mol. Its IUPAC name is 1-(2-chloro-6-methoxyphenyl)-2,2-difluoropropan-1-one.
| Compound Name | 1-(2-chloro-6-methoxyphenyl)-2,2-difluoropropan-1-one |
|---|---|
| PubChem CID | 131187635 |
| Molecular Formula | C10H9ClF2O2 |
| Molecular Weight | 234.63 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 1-(2-chloro-6-methoxyphenyl)-2,2-difluoropropan-1-one |
| SMILES | COc1cccc(Cl)c1C(=O)C(C)(F)F |
| InChI | InChI=1S/C10H9ClF2O2/c1-10(12,13)9(14)8-6(11)4-3-5-7(8)15-2/h3-5H,1-2H3 |
| InChIKey | WHIHEGYZYCFFLI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.63 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |