C14H15F3O2 — CID 113432684
(1-methoxycyclopentyl)-[2-(trifluoromethyl)phenyl]methanone (PubChem CID 113432684) has the molecular formula C14H15F3O2 and a molecular weight of 272.27 g/mol. Its IUPAC name is (1-methoxycyclopentyl)-[2-(trifluoromethyl)phenyl]methanone.
| Compound Name | (1-methoxycyclopentyl)-[2-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 113432684 |
| Molecular Formula | C14H15F3O2 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | (1-methoxycyclopentyl)-[2-(trifluoromethyl)phenyl]methanone |
| SMILES | COC1(C(=O)c2ccccc2C(F)(F)F)CCCC1 |
| InChI | InChI=1S/C14H15F3O2/c1-19-13(8-4-5-9-13)12(18)10-6-2-3-7-11(10)14(15,16)17/h2-3,6-7H,4-5,8-9H2,1H3 |
| InChIKey | JJFOJVGBQVMBAF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |